C12H19ClN2 — CID 142128660
1-[(2E,4E)-4-chlorohepta-2,4,6-trien-3-yl]-4-methylpiperazine (PubChem CID 142128660) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-[(2E,4E)-4-chlorohepta-2,4,6-trien-3-yl]-4-methylpiperazine.
| Compound Name | 1-[(2E,4E)-4-chlorohepta-2,4,6-trien-3-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142128660 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-[(2E,4E)-4-chlorohepta-2,4,6-trien-3-yl]-4-methylpiperazine |
| SMILES | C=C/C=C(Cl)\C(=C/C)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H19ClN2/c1-4-6-11(13)12(5-2)15-9-7-14(3)8-10-15/h4-6H,1,7-10H2,2-3H3/b11-6+,12-5+ |
| InChIKey | ZVUASGNELJCPBP-HFQMJBPSSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|