C12H20N2 — CID 91275510
1-hepta-1,3,5-trien-2-yl-4-methylpiperazine (PubChem CID 91275510) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-hepta-1,3,5-trien-2-yl-4-methylpiperazine.
| Compound Name | 1-hepta-1,3,5-trien-2-yl-4-methylpiperazine |
|---|---|
| PubChem CID | 91275510 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-hepta-1,3,5-trien-2-yl-4-methylpiperazine |
| SMILES | C=C(C=CC=CC)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H20N2/c1-4-5-6-7-12(2)14-10-8-13(3)9-11-14/h4-7H,2,8-11H2,1,3H3 |
| InChIKey | PCUVULPPXGXLOX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|