About (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride
(1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride (PubChem CID 90305285) has the molecular formula C10H17ClN4
and a molecular weight of 228.73 g/mol. Its IUPAC name is (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride.
Molecular Properties
| Compound Name | (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride |
| PubChem CID | 90305285 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride |
| SMILES | C=C(/C=C\C(Cl)=N/N)N1CCN(C)CC1 |
| InChI | InChI=1S/C10H17ClN4/c1-9(3-4-10(11)13-12)15-7-5-14(2)6-8-15/h3-4H,1,5-8,12H2,2H3/b4-3-,13-10+ |
| InChIKey | ISFKEANQRXCBME-ANKWKMGHSA-N |
| XLogP | 0.81 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride?
The IUPAC name of (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride (CID 90305285) is (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride.
What is the SMILES notation for (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride?
The canonical SMILES for (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride is C=C(/C=C\C(Cl)=N/N)N1CCN(C)CC1.
What is the InChIKey of (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride?
The InChIKey is ISFKEANQRXCBME-ANKWKMGHSA-N. The full InChI is InChI=1S/C10H17ClN4/c1-9(3-4-10(11)13-12)15-7-5-14(2)6-8-15/h3-4H,1,5-8,12H2,2H3/b4-3-,13-10+.
What are the key properties of (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride?
(1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride has a molecular weight of 228.73 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,2Z)-4-(4-methylpiperazin-1-yl)penta-2,4-dienehydrazonoyl chloride is sourced from PubChem (CID 90305285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).