C12H19ClN2 — CID 142128716
1-[(3E,5Z)-4-chlorohepta-1,3,5-trien-2-yl]-4-methylpiperazine (PubChem CID 142128716) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-[(3E,5Z)-4-chlorohepta-1,3,5-trien-2-yl]-4-methylpiperazine.
| Compound Name | 1-[(3E,5Z)-4-chlorohepta-1,3,5-trien-2-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142128716 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-[(3E,5Z)-4-chlorohepta-1,3,5-trien-2-yl]-4-methylpiperazine |
| SMILES | C=C(/C=C(Cl)\C=C/C)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H19ClN2/c1-4-5-12(13)10-11(2)15-8-6-14(3)7-9-15/h4-5,10H,2,6-9H2,1,3H3/b5-4-,12-10+ |
| InChIKey | JYEZWYPDFLTBMV-KYTHIUCFSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|