C11H19ClN2 — CID 142272139
1-[(2Z,4Z)-2-chlorohexa-2,4-dien-3-yl]-4-methylpiperazine (PubChem CID 142272139) has the molecular formula C11H19ClN2 and a molecular weight of 214.74 g/mol. Its IUPAC name is 1-[(2Z,4Z)-2-chlorohexa-2,4-dien-3-yl]-4-methylpiperazine.
| Compound Name | 1-[(2Z,4Z)-2-chlorohexa-2,4-dien-3-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142272139 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-[(2Z,4Z)-2-chlorohexa-2,4-dien-3-yl]-4-methylpiperazine |
| SMILES | C/C=C\C(=C(/C)Cl)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H19ClN2/c1-4-5-11(10(2)12)14-8-6-13(3)7-9-14/h4-5H,6-9H2,1-3H3/b5-4-,11-10- |
| InChIKey | ZORAXHOMPIDBAU-NKIGAPEHSA-N |
| XLogP | 2.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|