C11H20ClN3 — CID 142969804
(2Z,4Z)-5-chloro-4-(4-methylpiperazin-1-yl)hexa-2,4-dien-1-amine (PubChem CID 142969804) has the molecular formula C11H20ClN3 and a molecular weight of 229.75 g/mol. Its IUPAC name is (2Z,4Z)-5-chloro-4-(4-methylpiperazin-1-yl)hexa-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-5-chloro-4-(4-methylpiperazin-1-yl)hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142969804 |
| Molecular Formula | C11H20ClN3 |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (2Z,4Z)-5-chloro-4-(4-methylpiperazin-1-yl)hexa-2,4-dien-1-amine |
| SMILES | C/C(Cl)=C(\C=C/CN)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H20ClN3/c1-10(12)11(4-3-5-13)15-8-6-14(2)7-9-15/h3-4H,5-9,13H2,1-2H3/b4-3-,11-10- |
| InChIKey | MVFKZRAKONCKPQ-WXRHCNDASA-N |
| XLogP | 1.22 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|