C10H17N3 — CID 89008861
(1Z,3E)-3-piperazin-1-ylhexa-1,3,5-trien-1-amine (PubChem CID 89008861) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (1Z,3E)-3-piperazin-1-ylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-piperazin-1-ylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89008861 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (1Z,3E)-3-piperazin-1-ylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)N1CCNCC1 |
| InChI | InChI=1S/C10H17N3/c1-2-3-10(4-5-11)13-8-6-12-7-9-13/h2-5,12H,1,6-9,11H2/b5-4-,10-3+ |
| InChIKey | APZXDQWXOSZJAB-MZTCIMCMSA-N |
| XLogP | 0.43 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|