C11H18N2 — CID 123183932
1-hepta-1,3,5-trien-3-ylpiperazine (PubChem CID 123183932) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-hepta-1,3,5-trien-3-ylpiperazine.
| Compound Name | 1-hepta-1,3,5-trien-3-ylpiperazine |
|---|---|
| PubChem CID | 123183932 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-hepta-1,3,5-trien-3-ylpiperazine |
| SMILES | C=CC(=CC=CC)N1CCNCC1 |
| InChI | InChI=1S/C11H18N2/c1-3-5-6-11(4-2)13-9-7-12-8-10-13/h3-6,12H,2,7-10H2,1H3 |
| InChIKey | PNBLEOBOYJTHKG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|