C32H50N2O3 — CID 143875933
(3S)-5-[2-(9-methoxy-2,3-dihydro-[1,4]oxazino[2,3-c]quinolin-1-yl)ethyl]-3-methyloct-1-en-2-ol;propylcyclohexane (PubChem CID 143875933) has the molecular formula C32H50N2O3 and a molecular weight of 510.76 g/mol. Its IUPAC name is (3S)-5-[2-(9-methoxy-2,3-dihydro-[1,4]oxazino[2,3-c]quinolin-1-yl)ethyl]-3-methyloct-1-en-2-ol;propylcyclohexane.
| Compound Name | (3S)-5-[2-(9-methoxy-2,3-dihydro-[1,4]oxazino[2,3-c]quinolin-1-yl)ethyl]-3-methyloct-1-en-2-ol;propylcyclohexane |
|---|---|
| PubChem CID | 143875933 |
| Molecular Formula | C32H50N2O3 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.38 |
| IUPAC Name | (3S)-5-[2-(9-methoxy-2,3-dihydro-[1,4]oxazino[2,3-c]quinolin-1-yl)ethyl]-3-methyloct-1-en-2-ol;propylcyclohexane |
| SMILES | C=C(O)[C@@H](C)CC(CCC)CCN1CCOc2cnc3ccc(OC)cc3c21.CCCC1CCCCC1 |
| InChI | InChI=1S/C23H32N2O3.C9H18/c1-5-6-18(13-16(2)17(3)26)9-10-25-11-12-28-22-15-24-21-8-7-19(27-4)14-20(21)23(22)25;1-2-6-9-7-4-3-5-8-9/h7-8,14-16,18,26H,3,5-6,9-13H2,1-2,4H3;9H,2-8H2,1H3/t16-,18?;/m0./s1 |
| InChIKey | UOXYREVLTFCWFN-DMYPFFKMSA-N |
| XLogP | 8.71 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|