C26H36ClN3O4 — CID 22468588
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(2-cyclopentylethyl)-N-hydroxypiperidine-4-carboxamide (PubChem CID 22468588) has the molecular formula C26H36ClN3O4 and a molecular weight of 490.04 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(2-cyclopentylethyl)-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(2-cyclopentylethyl)-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22468588 |
| Molecular Formula | C26H36ClN3O4 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(2-cyclopentylethyl)-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(C(O)CCC3(C(=O)NO)CCN(CCC4CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C26H36ClN3O4/c1-34-19-6-7-22-20(16-19)24(21(27)17-28-22)23(31)8-10-26(25(32)29-33)11-14-30(15-12-26)13-9-18-4-2-3-5-18/h6-7,16-18,23,31,33H,2-5,8-15H2,1H3,(H,29,32) |
| InChIKey | TUNFTTRNEAQJAG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|