C28H41FN4O3 — CID 20796217
4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-(2-cyclohexylethyl)-N-hydroxypiperidine-4-carboxamide (PubChem CID 20796217) has the molecular formula C28H41FN4O3 and a molecular weight of 500.66 g/mol. Its IUPAC name is 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-(2-cyclohexylethyl)-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-(2-cyclohexylethyl)-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796217 |
| Molecular Formula | C28H41FN4O3 |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-(2-cyclohexylethyl)-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN)c([C@H](F)CCC3(C(=O)NO)CCN(CCC4CCCCC4)CC3)c2c1 |
| InChI | InChI=1S/C28H41FN4O3/c1-36-22-7-8-25-23(17-22)26(21(18-30)19-31-25)24(29)9-11-28(27(34)32-35)12-15-33(16-13-28)14-10-20-5-3-2-4-6-20/h7-8,17,19-20,24,35H,2-6,9-16,18,30H2,1H3,(H,32,34)/t24-/m1/s1 |
| InChIKey | NGQMGPVHLMBXRW-XMMPIXPASA-N |
| XLogP | 5.05 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|