C28H34F2N4O5 — CID 20797266
4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 20797266) has the molecular formula C28H34F2N4O5 and a molecular weight of 544.60 g/mol. Its IUPAC name is 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797266 |
| Molecular Formula | C28H34F2N4O5 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 4-[(3R)-3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN)c([C@H](O)CCC3(C(=O)NO)CCN(CCOc4cc(F)cc(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C28H34F2N4O5/c1-38-21-2-3-24-23(15-21)26(18(16-31)17-32-24)25(35)4-5-28(27(36)33-37)6-8-34(9-7-28)10-11-39-22-13-19(29)12-20(30)14-22/h2-3,12-15,17,25,35,37H,4-11,16,31H2,1H3,(H,33,36)/t25-/m1/s1 |
| InChIKey | DZSMDPUYNJDRKD-RUZDIDTESA-N |
| XLogP | 3.46 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|