C29H35F3N4O5 — CID 20797745
4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[2-(2,4,6-trifluorophenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 20797745) has the molecular formula C29H35F3N4O5 and a molecular weight of 576.62 g/mol. Its IUPAC name is 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[2-(2,4,6-trifluorophenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[2-(2,4,6-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797745 |
| Molecular Formula | C29H35F3N4O5 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 4-[(3R)-3-[3-(dimethylamino)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[2-(2,4,6-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(N(C)C)c([C@H](O)CCC3(C(=O)NO)CCN(CCOc4c(F)cc(F)cc4F)CC3)c2c1 |
| InChI | InChI=1S/C29H35F3N4O5/c1-35(2)24-17-33-23-5-4-19(40-3)16-20(23)26(24)25(37)6-7-29(28(38)34-39)8-10-36(11-9-29)12-13-41-27-21(31)14-18(30)15-22(27)32/h4-5,14-17,25,37,39H,6-13H2,1-3H3,(H,34,38)/t25-/m1/s1 |
| InChIKey | RRQXQHKARJMIME-RUZDIDTESA-N |
| XLogP | 4.21 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|