C27H29F4N3O5 — CID 20797847
4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 20797847) has the molecular formula C27H29F4N3O5 and a molecular weight of 551.54 g/mol. Its IUPAC name is 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797847 |
| Molecular Formula | C27H29F4N3O5 |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(F)c([C@H](O)CCC3(C(=O)NO)CCN(CCOc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C27H29F4N3O5/c1-38-16-2-3-22-18(12-16)24(21(30)15-32-22)23(35)4-5-27(26(36)33-37)6-8-34(9-7-27)10-11-39-17-13-19(28)25(31)20(29)14-17/h2-3,12-15,23,35,37H,4-11H2,1H3,(H,33,36)/t23-/m1/s1 |
| InChIKey | DUECHCGXFBKESV-HSZRJFAPSA-N |
| XLogP | 4.28 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|