C28H27F4N3O4 — CID 20797897
4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide (PubChem CID 20797897) has the molecular formula C28H27F4N3O4 and a molecular weight of 545.53 g/mol. Its IUPAC name is 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797897 |
| Molecular Formula | C28H27F4N3O4 |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 4-[(3R)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(F)c([C@H](O)CCC3(C(=O)NO)CCN(CC#Cc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C28H27F4N3O4/c1-39-18-4-5-23-19(15-18)25(22(31)16-33-23)24(36)6-7-28(27(37)34-38)8-11-35(12-9-28)10-2-3-17-13-20(29)26(32)21(30)14-17/h4-5,13-16,24,36,38H,6-12H2,1H3,(H,34,37)/t24-/m1/s1 |
| InChIKey | XCMCLFZESUDDAY-XMMPIXPASA-N |
| XLogP | 4.25 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|