C29H31F3N2O3 — CID 20798165
(1R)-3-[4-(hydroxymethyl)-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]-1-(6-methoxy-3-methylquinolin-4-yl)propan-1-ol (PubChem CID 20798165) has the molecular formula C29H31F3N2O3 and a molecular weight of 512.57 g/mol. Its IUPAC name is (1R)-3-[4-(hydroxymethyl)-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]-1-(6-methoxy-3-methylquinolin-4-yl)propan-1-ol.
| Compound Name | (1R)-3-[4-(hydroxymethyl)-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]-1-(6-methoxy-3-methylquinolin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 20798165 |
| Molecular Formula | C29H31F3N2O3 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (1R)-3-[4-(hydroxymethyl)-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]-1-(6-methoxy-3-methylquinolin-4-yl)propan-1-ol |
| SMILES | COc1ccc2ncc(C)c([C@H](O)CCC3(CO)CCN(CC#Cc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C29H31F3N2O3/c1-19-17-33-25-6-5-21(37-2)16-22(25)27(19)26(36)7-8-29(18-35)9-12-34(13-10-29)11-3-4-20-14-23(30)28(32)24(31)15-20/h5-6,14-17,26,35-36H,7-13,18H2,1-2H3/t26-/m1/s1 |
| InChIKey | ZBCOARBTDLXUJL-AREMUKBSSA-N |
| XLogP | 4.91 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|