C28H27ClF4N2O2 — CID 22468733
[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol (PubChem CID 22468733) has the molecular formula C28H27ClF4N2O2 and a molecular weight of 534.98 g/mol. Its IUPAC name is [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22468733 |
| Molecular Formula | C28H27ClF4N2O2 |
| Molecular Weight | 534.98 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | [4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(CO)CCN(CC#Cc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C28H27ClF4N2O2/c1-37-19-4-5-25-20(15-19)26(21(29)16-34-25)22(30)6-7-28(17-36)8-11-35(12-9-28)10-2-3-18-13-23(31)27(33)24(32)14-18/h4-5,13-16,22,36H,6-12,17H2,1H3 |
| InChIKey | JZMVZHNLHJMEMX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.98 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|