C29H31F4N3O2 — CID 22470361
[4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol (PubChem CID 22470361) has the molecular formula C29H31F4N3O2 and a molecular weight of 529.58 g/mol. Its IUPAC name is [4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22470361 |
| Molecular Formula | C29H31F4N3O2 |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | [4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-fluoropropyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(CN)c(C(F)CCC3(CO)CCN(CC#Cc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C29H31F4N3O2/c1-38-22-4-5-26-23(15-22)27(20(16-34)17-35-26)24(31)6-7-29(18-37)8-11-36(12-9-29)10-2-3-19-13-21(30)14-25(32)28(19)33/h4-5,13-15,17,24,37H,6-12,16,18,34H2,1H3 |
| InChIKey | XROJDGYHNWFREI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|