C33H35F4N3O4 — CID 20797198
4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid (PubChem CID 20797198) has the molecular formula C33H35F4N3O4 and a molecular weight of 613.65 g/mol. Its IUPAC name is 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid.
| Compound Name | 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 20797198 |
| Molecular Formula | C33H35F4N3O4 |
| Molecular Weight | 613.65 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c([C@H](F)CCC3(C(=O)O)CCN(CC#Cc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C33H35F4N3O4/c1-43-25-4-5-29-26(19-25)30(23(20-38-29)21-40-13-15-44-16-14-40)27(35)6-7-33(32(41)42)8-11-39(12-9-33)10-2-3-22-17-24(34)18-28(36)31(22)37/h4-5,17-20,27H,6-16,21H2,1H3,(H,41,42)/t27-/m1/s1 |
| InChIKey | UAMRYBXJAIGBGK-HHHXNRCGSA-N |
| XLogP | 5.50 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|