C33H40F4N4O4 — CID 20797218
4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide (PubChem CID 20797218) has the molecular formula C33H40F4N4O4 and a molecular weight of 632.70 g/mol. Its IUPAC name is 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797218 |
| Molecular Formula | C33H40F4N4O4 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[3-(3,4,5-trifluorophenyl)propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c([C@H](F)CCC3(C(=O)NO)CCN(CCCc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C33H40F4N4O4/c1-44-24-4-5-29-25(19-24)30(23(20-38-29)21-41-13-15-45-16-14-41)26(34)6-7-33(32(42)39-43)8-11-40(12-9-33)10-2-3-22-17-27(35)31(37)28(36)18-22/h4-5,17-20,26,43H,2-3,6-16,21H2,1H3,(H,39,42)/t26-/m1/s1 |
| InChIKey | LCIQJYJQYVTGQD-AREMUKBSSA-N |
| XLogP | 5.50 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|