C33H36F4N4O4 — CID 20797199
4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide (PubChem CID 20797199) has the molecular formula C33H36F4N4O4 and a molecular weight of 628.67 g/mol. Its IUPAC name is 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797199 |
| Molecular Formula | C33H36F4N4O4 |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | 4-[(3R)-3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c([C@H](F)CCC3(C(=O)NO)CCN(CC#Cc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C33H36F4N4O4/c1-44-25-4-5-29-26(19-25)30(23(20-38-29)21-41-13-15-45-16-14-41)27(35)6-7-33(32(42)39-43)8-11-40(12-9-33)10-2-3-22-17-24(34)18-28(36)31(22)37/h4-5,17-20,27,43H,6-16,21H2,1H3,(H,39,42)/t27-/m1/s1 |
| InChIKey | MZHNROKAFYZMLW-HHHXNRCGSA-N |
| XLogP | 4.92 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|