C34H38F3N3O5 — CID 22470729
2-[4-[3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid (PubChem CID 22470729) has the molecular formula C34H38F3N3O5 and a molecular weight of 625.69 g/mol. Its IUPAC name is 2-[4-[3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22470729 |
| Molecular Formula | C34H38F3N3O5 |
| Molecular Weight | 625.69 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | 2-[4-[3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c(C(O)CCC3(CC(=O)O)CCN(CC#Cc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C34H38F3N3O5/c1-44-26-4-5-29-27(19-26)32(24(21-38-29)22-40-13-15-45-16-14-40)30(41)6-7-34(20-31(42)43)8-11-39(12-9-34)10-2-3-23-17-25(35)18-28(36)33(23)37/h4-5,17-19,21,30,41H,6-16,20,22H2,1H3,(H,42,43) |
| InChIKey | UWFFUBOCFAEOKJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 95.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|