C29H31F3N4O4 — CID 22468770
4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide (PubChem CID 22468770) has the molecular formula C29H31F3N4O4 and a molecular weight of 556.59 g/mol. Its IUPAC name is 4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22468770 |
| Molecular Formula | C29H31F3N4O4 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 4-[3-[3-(aminomethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-[3-(2,3,5-trifluorophenyl)prop-2-ynyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN)c(C(O)CCC3(C(=O)NO)CCN(CC#Cc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C29H31F3N4O4/c1-40-21-4-5-24-22(15-21)26(19(16-33)17-34-24)25(37)6-7-29(28(38)35-39)8-11-36(12-9-29)10-2-3-18-13-20(30)14-23(31)27(18)32/h4-5,13-15,17,25,37,39H,6-12,16,33H2,1H3,(H,35,38) |
| InChIKey | PQGZZKHIORLLGZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|