C27H30FN3O4S — CID 20798001
4-[(3R)-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-(3-thiophen-2-ylprop-2-ynyl)piperidine-4-carboxamide (PubChem CID 20798001) has the molecular formula C27H30FN3O4S and a molecular weight of 511.62 g/mol. Its IUPAC name is 4-[(3R)-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-(3-thiophen-2-ylprop-2-ynyl)piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-(3-thiophen-2-ylprop-2-ynyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20798001 |
| Molecular Formula | C27H30FN3O4S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 4-[(3R)-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]-3-hydroxypropyl]-N-hydroxy-1-(3-thiophen-2-ylprop-2-ynyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CF)c([C@H](O)CCC3(C(=O)NO)CCN(CC#Cc4cccs4)CC3)c2c1 |
| InChI | InChI=1S/C27H30FN3O4S/c1-35-20-6-7-23-22(16-20)25(19(17-28)18-29-23)24(32)8-9-27(26(33)30-34)10-13-31(14-11-27)12-2-4-21-5-3-15-36-21/h3,5-7,15-16,18,24,32,34H,8-14,17H2,1H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | HXLRQDJEWPMKCX-XMMPIXPASA-N |
| XLogP | 4.23 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|