C25H26ClFN4O3S — CID 22469168
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]piperidine-4-carboxamide (PubChem CID 22469168) has the molecular formula C25H26ClFN4O3S and a molecular weight of 517.03 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22469168 |
| Molecular Formula | C25H26ClFN4O3S |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-[3-(1,3-thiazol-2-yl)prop-2-ynyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(C(=O)NO)CCN(CC#Cc4nccs4)CC3)c2c1 |
| InChI | InChI=1S/C25H26ClFN4O3S/c1-34-17-4-5-21-18(15-17)23(19(26)16-29-21)20(27)6-7-25(24(32)30-33)8-12-31(13-9-25)11-2-3-22-28-10-14-35-22/h4-5,10,14-16,20,33H,6-9,11-13H2,1H3,(H,30,32) |
| InChIKey | WQKGXEPVLQYNTJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|