C27H28ClFN4O3 — CID 20796593
4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyridin-2-ylprop-2-ynyl)piperidine-4-carboxamide (PubChem CID 20796593) has the molecular formula C27H28ClFN4O3 and a molecular weight of 511.00 g/mol. Its IUPAC name is 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyridin-2-ylprop-2-ynyl)piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyridin-2-ylprop-2-ynyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796593 |
| Molecular Formula | C27H28ClFN4O3 |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyridin-2-ylprop-2-ynyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c([C@H](F)CCC3(C(=O)NO)CCN(CC#Cc4ccccn4)CC3)c2c1 |
| InChI | InChI=1S/C27H28ClFN4O3/c1-36-20-7-8-24-21(17-20)25(22(28)18-31-24)23(29)9-10-27(26(34)32-35)11-15-33(16-12-27)14-4-6-19-5-2-3-13-30-19/h2-3,5,7-8,13,17-18,23,35H,9-12,14-16H2,1H3,(H,32,34)/t23-/m1/s1 |
| InChIKey | QAQKFHARKQPCCL-HSZRJFAPSA-N |
| XLogP | 4.72 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|