C28H27Cl2F2N3O3 — CID 20796457
1-[3-(2-chloro-4-fluorophenyl)prop-2-ynyl]-4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 20796457) has the molecular formula C28H27Cl2F2N3O3 and a molecular weight of 562.44 g/mol. Its IUPAC name is 1-[3-(2-chloro-4-fluorophenyl)prop-2-ynyl]-4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-[3-(2-chloro-4-fluorophenyl)prop-2-ynyl]-4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796457 |
| Molecular Formula | C28H27Cl2F2N3O3 |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 1-[3-(2-chloro-4-fluorophenyl)prop-2-ynyl]-4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c([C@H](F)CCC3(C(=O)NO)CCN(CC#Cc4ccc(F)cc4Cl)CC3)c2c1 |
| InChI | InChI=1S/C28H27Cl2F2N3O3/c1-38-20-6-7-25-21(16-20)26(23(30)17-33-25)24(32)8-9-28(27(36)34-37)10-13-35(14-11-28)12-2-3-18-4-5-19(31)15-22(18)29/h4-7,15-17,24,37H,8-14H2,1H3,(H,34,36)/t24-/m1/s1 |
| InChIKey | RUCNQSISNMOMBB-XMMPIXPASA-N |
| XLogP | 6.12 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|