C28H33ClFN3O4S — CID 22468842
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-[2-(4-methoxyphenyl)sulfanylethyl]piperidine-4-carboxamide (PubChem CID 22468842) has the molecular formula C28H33ClFN3O4S and a molecular weight of 562.11 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-[2-(4-methoxyphenyl)sulfanylethyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-[2-(4-methoxyphenyl)sulfanylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22468842 |
| Molecular Formula | C28H33ClFN3O4S |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-[2-(4-methoxyphenyl)sulfanylethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(SCCN2CCC(CCC(F)c3c(Cl)cnc4ccc(OC)cc34)(C(=O)NO)CC2)cc1 |
| InChI | InChI=1S/C28H33ClFN3O4S/c1-36-19-3-6-21(7-4-19)38-16-15-33-13-11-28(12-14-33,27(34)32-35)10-9-24(30)26-22-17-20(37-2)5-8-25(22)31-18-23(26)29/h3-8,17-18,24,35H,9-16H2,1-2H3,(H,32,34) |
| InChIKey | OAGQTZUPYQMVII-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|