C29H33ClF3N3O4S — CID 20797611
4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[3-[4-(trifluoromethyl)phenyl]sulfanylpropyl]piperidine-4-carboxamide (PubChem CID 20797611) has the molecular formula C29H33ClF3N3O4S and a molecular weight of 612.11 g/mol. Its IUPAC name is 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[3-[4-(trifluoromethyl)phenyl]sulfanylpropyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[3-[4-(trifluoromethyl)phenyl]sulfanylpropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797611 |
| Molecular Formula | C29H33ClF3N3O4S |
| Molecular Weight | 612.11 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-N-hydroxy-1-[3-[4-(trifluoromethyl)phenyl]sulfanylpropyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c([C@H](O)CCC3(C(=O)NO)CCN(CCCSc4ccc(C(F)(F)F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C29H33ClF3N3O4S/c1-40-20-5-8-24-22(17-20)26(23(30)18-34-24)25(37)9-10-28(27(38)35-39)11-14-36(15-12-28)13-2-16-41-21-6-3-19(4-7-21)29(31,32)33/h3-8,17-18,25,37,39H,2,9-16H2,1H3,(H,35,38)/t25-/m1/s1 |
| InChIKey | MJANLWKLCKDTFE-RUZDIDTESA-N |
| XLogP | 6.50 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.11 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|