C28H32Cl2FN3O3S — CID 22471091
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(4-chlorophenyl)sulfanylpropyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 22471091) has the molecular formula C28H32Cl2FN3O3S and a molecular weight of 580.55 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(4-chlorophenyl)sulfanylpropyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(4-chlorophenyl)sulfanylpropyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22471091 |
| Molecular Formula | C28H32Cl2FN3O3S |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(4-chlorophenyl)sulfanylpropyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(C(=O)NO)CCN(CCCSc4ccc(Cl)cc4)CC3)c2c1 |
| InChI | InChI=1S/C28H32Cl2FN3O3S/c1-37-20-5-8-25-22(17-20)26(23(30)18-32-25)24(31)9-10-28(27(35)33-36)11-14-34(15-12-28)13-2-16-38-21-6-3-19(29)4-7-21/h3-8,17-18,24,36H,2,9-16H2,1H3,(H,33,35) |
| InChIKey | TUJZISXGNCACMF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|