C27H32ClFN4O3S — CID 22470188
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyridin-2-ylsulfanylpropyl)piperidine-4-carboxamide (PubChem CID 22470188) has the molecular formula C27H32ClFN4O3S and a molecular weight of 547.10 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyridin-2-ylsulfanylpropyl)piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyridin-2-ylsulfanylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22470188 |
| Molecular Formula | C27H32ClFN4O3S |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyridin-2-ylsulfanylpropyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(C(=O)NO)CCN(CCCSc4ccccn4)CC3)c2c1 |
| InChI | InChI=1S/C27H32ClFN4O3S/c1-36-19-6-7-23-20(17-19)25(21(28)18-31-23)22(29)8-9-27(26(34)32-35)10-14-33(15-11-27)13-4-16-37-24-5-2-3-12-30-24/h2-3,5-7,12,17-18,22,35H,4,8-11,13-16H2,1H3,(H,32,34) |
| InChIKey | AFGBSSUMIOUHIW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|