C26H31ClFN5O3S — CID 22470374
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyrazin-2-ylsulfanylpropyl)piperidine-4-carboxamide (PubChem CID 22470374) has the molecular formula C26H31ClFN5O3S and a molecular weight of 548.08 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyrazin-2-ylsulfanylpropyl)piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyrazin-2-ylsulfanylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22470374 |
| Molecular Formula | C26H31ClFN5O3S |
| Molecular Weight | 548.08 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-pyrazin-2-ylsulfanylpropyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(C(=O)NO)CCN(CCCSc4cnccn4)CC3)c2c1 |
| InChI | InChI=1S/C26H31ClFN5O3S/c1-36-18-3-4-22-19(15-18)24(20(27)16-31-22)21(28)5-6-26(25(34)32-35)7-12-33(13-8-26)11-2-14-37-23-17-29-9-10-30-23/h3-4,9-10,15-17,21,35H,2,5-8,11-14H2,1H3,(H,32,34) |
| InChIKey | ACJUBKQPTPHAJB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.08 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|