C28H33ClFN3O3 — CID 20796577
4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-phenylpropyl)piperidine-4-carboxamide (PubChem CID 20796577) has the molecular formula C28H33ClFN3O3 and a molecular weight of 514.04 g/mol. Its IUPAC name is 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796577 |
| Molecular Formula | C28H33ClFN3O3 |
| Molecular Weight | 514.04 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-N-hydroxy-1-(3-phenylpropyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c([C@H](F)CCC3(C(=O)NO)CCN(CCCc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C28H33ClFN3O3/c1-36-21-9-10-25-22(18-21)26(23(29)19-31-25)24(30)11-12-28(27(34)32-35)13-16-33(17-14-28)15-5-8-20-6-3-2-4-7-20/h2-4,6-7,9-10,18-19,24,35H,5,8,11-17H2,1H3,(H,32,34)/t24-/m1/s1 |
| InChIKey | RZNDYJQAVJASSY-XMMPIXPASA-N |
| XLogP | 5.91 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.04 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|