C28H31ClF3N3O3S — CID 22469998
4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(2,3-difluorophenyl)sulfanylpropyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 22469998) has the molecular formula C28H31ClF3N3O3S and a molecular weight of 582.09 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(2,3-difluorophenyl)sulfanylpropyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(2,3-difluorophenyl)sulfanylpropyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22469998 |
| Molecular Formula | C28H31ClF3N3O3S |
| Molecular Weight | 582.09 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(2,3-difluorophenyl)sulfanylpropyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(C(=O)NO)CCN(CCCSc4cccc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C28H31ClF3N3O3S/c1-38-18-6-7-23-19(16-18)25(20(29)17-33-23)21(30)8-9-28(27(36)34-37)10-13-35(14-11-28)12-3-15-39-24-5-2-4-22(31)26(24)32/h2,4-7,16-17,21,37H,3,8-15H2,1H3,(H,34,36) |
| InChIKey | PNOSNQJPOWWLES-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.09 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|