C27H30ClF2N3O4S — CID 20797349
4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[2-(2,6-difluorophenyl)sulfanylethyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 20797349) has the molecular formula C27H30ClF2N3O4S and a molecular weight of 566.07 g/mol. Its IUPAC name is 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[2-(2,6-difluorophenyl)sulfanylethyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[2-(2,6-difluorophenyl)sulfanylethyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797349 |
| Molecular Formula | C27H30ClF2N3O4S |
| Molecular Weight | 566.07 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 4-[(3R)-3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[2-(2,6-difluorophenyl)sulfanylethyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c([C@H](O)CCC3(C(=O)NO)CCN(CCSc4c(F)cccc4F)CC3)c2c1 |
| InChI | InChI=1S/C27H30ClF2N3O4S/c1-37-17-5-6-22-18(15-17)24(19(28)16-31-22)23(34)7-8-27(26(35)32-36)9-11-33(12-10-27)13-14-38-25-20(29)3-2-4-21(25)30/h2-6,15-16,23,34,36H,7-14H2,1H3,(H,32,35)/t23-/m1/s1 |
| InChIKey | GVSOTFKFOOARHI-HSZRJFAPSA-N |
| XLogP | 5.37 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.07 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|