C28H31F4N3O4S — CID 22468907
4-[3-fluoro-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[2-(2,4,6-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide (PubChem CID 22468907) has the molecular formula C28H31F4N3O4S and a molecular weight of 581.63 g/mol. Its IUPAC name is 4-[3-fluoro-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[2-(2,4,6-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-fluoro-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[2-(2,4,6-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22468907 |
| Molecular Formula | C28H31F4N3O4S |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 4-[3-fluoro-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[2-(2,4,6-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CO)c(C(F)CCC3(C(=O)NO)CCN(CCSc4c(F)cc(F)cc4F)CC3)c2c1 |
| InChI | InChI=1S/C28H31F4N3O4S/c1-39-19-2-3-24-20(14-19)25(17(16-36)15-33-24)21(30)4-5-28(27(37)34-38)6-8-35(9-7-28)10-11-40-26-22(31)12-18(29)13-23(26)32/h2-3,12-15,21,36,38H,4-11,16H2,1H3,(H,34,37) |
| InChIKey | LRZOYDSKNCZTBD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|