C28H30F5N3O3S — CID 20796878
4-[(3R)-3-fluoro-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[2-(2,3,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide (PubChem CID 20796878) has the molecular formula C28H30F5N3O3S and a molecular weight of 583.62 g/mol. Its IUPAC name is 4-[(3R)-3-fluoro-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[2-(2,3,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide.
| Compound Name | 4-[(3R)-3-fluoro-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[2-(2,3,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20796878 |
| Molecular Formula | C28H30F5N3O3S |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 4-[(3R)-3-fluoro-3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxy-1-[2-(2,3,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CF)c([C@H](F)CCC3(C(=O)NO)CCN(CCSc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C28H30F5N3O3S/c1-39-19-2-3-23-20(14-19)25(17(15-29)16-34-23)21(31)4-5-28(27(37)35-38)6-8-36(9-7-28)10-11-40-24-13-18(30)12-22(32)26(24)33/h2-3,12-14,16,21,38H,4-11,15H2,1H3,(H,35,37)/t21-/m1/s1 |
| InChIKey | PIYYYIJXFOBJBK-OAQYLSRUSA-N |
| XLogP | 6.30 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|