C32H38F4N4O4S — CID 22469044
4-[3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide (PubChem CID 22469044) has the molecular formula C32H38F4N4O4S and a molecular weight of 650.74 g/mol. Its IUPAC name is 4-[3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22469044 |
| Molecular Formula | C32H38F4N4O4S |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 4-[3-fluoro-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-N-hydroxy-1-[2-(3,4,5-trifluorophenyl)sulfanylethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c(C(F)CCC3(C(=O)NO)CCN(CCSc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C32H38F4N4O4S/c1-43-22-2-3-28-24(16-22)29(21(19-37-28)20-40-10-13-44-14-11-40)25(33)4-5-32(31(41)38-42)6-8-39(9-7-32)12-15-45-23-17-26(34)30(36)27(35)18-23/h2-3,16-19,25,42H,4-15,20H2,1H3,(H,38,41) |
| InChIKey | DJYNQUNTYAIJHI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|