C32H40F3N5O5 — CID 20798212
N-hydroxy-4-[(3R)-3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidine-4-carboxamide (PubChem CID 20798212) has the molecular formula C32H40F3N5O5 and a molecular weight of 631.70 g/mol. Its IUPAC name is N-hydroxy-4-[(3R)-3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | N-hydroxy-4-[(3R)-3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20798212 |
| Molecular Formula | C32H40F3N5O5 |
| Molecular Weight | 631.70 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | N-hydroxy-4-[(3R)-3-hydroxy-3-[6-methoxy-3-(morpholin-4-ylmethyl)quinolin-4-yl]propyl]-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CN3CCOCC3)c([C@H](O)CCC3(C(=O)NO)CCN(CCNc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C32H40F3N5O5/c1-44-23-2-3-27-24(18-23)29(21(19-37-27)20-40-12-14-45-15-13-40)28(41)4-5-32(31(42)38-43)6-9-39(10-7-32)11-8-36-22-16-25(33)30(35)26(34)17-22/h2-3,16-19,28,36,41,43H,4-15,20H2,1H3,(H,38,42)/t28-/m1/s1 |
| InChIKey | SKKOCMKDVOQIGP-MUUNZHRXSA-N |
| XLogP | 4.01 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|