C28H33F3N4O5 — CID 20798021
N-hydroxy-4-[(3R)-3-hydroxy-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluoroanilino)ethyl]piperidine-4-carboxamide (PubChem CID 20798021) has the molecular formula C28H33F3N4O5 and a molecular weight of 562.59 g/mol. Its IUPAC name is N-hydroxy-4-[(3R)-3-hydroxy-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluoroanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | N-hydroxy-4-[(3R)-3-hydroxy-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluoroanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20798021 |
| Molecular Formula | C28H33F3N4O5 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | N-hydroxy-4-[(3R)-3-hydroxy-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-1-[2-(2,4,6-trifluoroanilino)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CO)c([C@H](O)CCC3(C(=O)NO)CCN(CCNc4c(F)cc(F)cc4F)CC3)c2c1 |
| InChI | InChI=1S/C28H33F3N4O5/c1-40-19-2-3-23-20(14-19)25(17(16-36)15-33-23)24(37)4-5-28(27(38)34-39)6-9-35(10-7-28)11-8-32-26-21(30)12-18(29)13-22(26)31/h2-3,12-15,24,32,36-37,39H,4-11,16H2,1H3,(H,34,38)/t24-/m1/s1 |
| InChIKey | AJRGCYBEPVWAIG-XMMPIXPASA-N |
| XLogP | 3.67 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|