C28H33F3N4O4 — CID 20797002
1-[2-(3,5-difluoroanilino)ethyl]-4-[(3R)-3-fluoro-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 20797002) has the molecular formula C28H33F3N4O4 and a molecular weight of 546.59 g/mol. Its IUPAC name is 1-[2-(3,5-difluoroanilino)ethyl]-4-[(3R)-3-fluoro-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-difluoroanilino)ethyl]-4-[(3R)-3-fluoro-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20797002 |
| Molecular Formula | C28H33F3N4O4 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 1-[2-(3,5-difluoroanilino)ethyl]-4-[(3R)-3-fluoro-3-[3-(hydroxymethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CO)c([C@H](F)CCC3(C(=O)NO)CCN(CCNc4cc(F)cc(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C28H33F3N4O4/c1-39-22-2-3-25-23(15-22)26(18(17-36)16-33-25)24(31)4-5-28(27(37)34-38)6-9-35(10-7-28)11-8-32-21-13-19(29)12-20(30)14-21/h2-3,12-16,24,32,36,38H,4-11,17H2,1H3,(H,34,37)/t24-/m1/s1 |
| InChIKey | MKHLNVIRBLNRMB-XMMPIXPASA-N |
| XLogP | 4.50 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|