C28H33F3N4O3 — CID 22470175
1-[2-(3,5-difluoroanilino)ethyl]-4-[3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 22470175) has the molecular formula C28H33F3N4O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is 1-[2-(3,5-difluoroanilino)ethyl]-4-[3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-difluoroanilino)ethyl]-4-[3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22470175 |
| Molecular Formula | C28H33F3N4O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 1-[2-(3,5-difluoroanilino)ethyl]-4-[3-[3-(fluoromethyl)-6-methoxyquinolin-4-yl]propyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(CF)c(CCCC3(C(=O)NO)CCN(CCNc4cc(F)cc(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C28H33F3N4O3/c1-38-23-4-5-26-25(16-23)24(19(17-29)18-33-26)3-2-6-28(27(36)34-37)7-10-35(11-8-28)12-9-32-22-14-20(30)13-21(31)15-22/h4-5,13-16,18,32,37H,2-3,6-12,17H2,1H3,(H,34,36) |
| InChIKey | JYIWTBKCGZRXLI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|