C28H33F2N3O4 — CID 22470095
1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxy-4-[3-(6-methoxy-3-methylquinolin-4-yl)propyl]piperidine-4-carboxamide (PubChem CID 22470095) has the molecular formula C28H33F2N3O4 and a molecular weight of 513.59 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxy-4-[3-(6-methoxy-3-methylquinolin-4-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxy-4-[3-(6-methoxy-3-methylquinolin-4-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22470095 |
| Molecular Formula | C28H33F2N3O4 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 1-[2-(3,5-difluorophenoxy)ethyl]-N-hydroxy-4-[3-(6-methoxy-3-methylquinolin-4-yl)propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(C)c(CCCC3(C(=O)NO)CCN(CCOc4cc(F)cc(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C28H33F2N3O4/c1-19-18-31-26-6-5-22(36-2)17-25(26)24(19)4-3-7-28(27(34)32-35)8-10-33(11-9-28)12-13-37-23-15-20(29)14-21(30)16-23/h5-6,14-18,35H,3-4,7-13H2,1-2H3,(H,32,34) |
| InChIKey | MAYFYTZCPKOZCT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|