C28H31ClF3N3O3 — CID 22468590
4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[3-(2,4,6-trifluorophenyl)propyl]piperidine-4-carboxamide (PubChem CID 22468590) has the molecular formula C28H31ClF3N3O3 and a molecular weight of 550.02 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[3-(2,4,6-trifluorophenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[3-(2,4,6-trifluorophenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22468590 |
| Molecular Formula | C28H31ClF3N3O3 |
| Molecular Weight | 550.02 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-[3-(2,4,6-trifluorophenyl)propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(C(=O)NO)CCN(CCCc4c(F)cc(F)cc4F)CC3)c2c1 |
| InChI | InChI=1S/C28H31ClF3N3O3/c1-38-19-6-7-26-22(16-19)20(23(29)17-33-26)4-2-8-28(27(36)34-37)9-12-35(13-10-28)11-3-5-21-24(31)14-18(30)15-25(21)32/h6-7,14-17,37H,2-5,8-13H2,1H3,(H,34,36) |
| InChIKey | CPMJJBLZDDJWAV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.02 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|