C27H29ClN4O3 — CID 22469069
4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(3-pyridin-2-ylprop-2-ynyl)piperidine-4-carboxamide (PubChem CID 22469069) has the molecular formula C27H29ClN4O3 and a molecular weight of 493.01 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(3-pyridin-2-ylprop-2-ynyl)piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(3-pyridin-2-ylprop-2-ynyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22469069 |
| Molecular Formula | C27H29ClN4O3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(3-pyridin-2-ylprop-2-ynyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(C(=O)NO)CCN(CC#Cc4ccccn4)CC3)c2c1 |
| InChI | InChI=1S/C27H29ClN4O3/c1-35-21-9-10-25-23(18-21)22(24(28)19-30-25)8-4-11-27(26(33)31-34)12-16-32(17-13-27)15-5-7-20-6-2-3-14-29-20/h2-3,6,9-10,14,18-19,34H,4,8,11-13,15-17H2,1H3,(H,31,33) |
| InChIKey | BMJLBYYYWKVZQE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|