C28H35ClN4O3 — CID 22470767
4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(4-pyridin-4-ylbutyl)piperidine-4-carboxamide (PubChem CID 22470767) has the molecular formula C28H35ClN4O3 and a molecular weight of 511.07 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(4-pyridin-4-ylbutyl)piperidine-4-carboxamide.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(4-pyridin-4-ylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22470767 |
| Molecular Formula | C28H35ClN4O3 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-N-hydroxy-1-(4-pyridin-4-ylbutyl)piperidine-4-carboxamide |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(C(=O)NO)CCN(CCCCc4ccncc4)CC3)c2c1 |
| InChI | InChI=1S/C28H35ClN4O3/c1-36-22-7-8-26-24(19-22)23(25(29)20-31-26)6-4-11-28(27(34)32-35)12-17-33(18-13-28)16-3-2-5-21-9-14-30-15-10-21/h7-10,14-15,19-20,35H,2-6,11-13,16-18H2,1H3,(H,32,34) |
| InChIKey | DBJWLCNDARLHHR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|