C27H37ClN2O3S — CID 22470629
4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-cyclopentylsulfanylpropyl)piperidine-4-carboxylic acid (PubChem CID 22470629) has the molecular formula C27H37ClN2O3S and a molecular weight of 505.12 g/mol. Its IUPAC name is 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-cyclopentylsulfanylpropyl)piperidine-4-carboxylic acid.
| Compound Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-cyclopentylsulfanylpropyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22470629 |
| Molecular Formula | C27H37ClN2O3S |
| Molecular Weight | 505.12 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(3-cyclopentylsulfanylpropyl)piperidine-4-carboxylic acid |
| SMILES | COc1ccc2ncc(Cl)c(CCCC3(C(=O)O)CCN(CCCSC4CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C27H37ClN2O3S/c1-33-20-9-10-25-23(18-20)22(24(28)19-29-25)8-4-11-27(26(31)32)12-15-30(16-13-27)14-5-17-34-21-6-2-3-7-21/h9-10,18-19,21H,2-8,11-17H2,1H3,(H,31,32) |
| InChIKey | FOSZFSUEOYXMCA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.12 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|