C29H41ClN2O4S — CID 22471490
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-cyclohexylsulfanylpropyl)piperidin-4-yl]acetic acid (PubChem CID 22471490) has the molecular formula C29H41ClN2O4S and a molecular weight of 549.18 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-cyclohexylsulfanylpropyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-cyclohexylsulfanylpropyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22471490 |
| Molecular Formula | C29H41ClN2O4S |
| Molecular Weight | 549.18 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-cyclohexylsulfanylpropyl)piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(C(O)CCC3(CC(=O)O)CCN(CCCSC4CCCCC4)CC3)c2c1 |
| InChI | InChI=1S/C29H41ClN2O4S/c1-36-21-8-9-25-23(18-21)28(24(30)20-31-25)26(33)10-11-29(19-27(34)35)12-15-32(16-13-29)14-5-17-37-22-6-3-2-4-7-22/h8-9,18,20,22,26,33H,2-7,10-17,19H2,1H3,(H,34,35) |
| InChIKey | BYOUUMOFNRPMTE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.18 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|