C30H37ClN2O4 — CID 22468833
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-phenylbutyl)piperidin-4-yl]acetic acid (PubChem CID 22468833) has the molecular formula C30H37ClN2O4 and a molecular weight of 525.09 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-phenylbutyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-phenylbutyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22468833 |
| Molecular Formula | C30H37ClN2O4 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(4-phenylbutyl)piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(C(O)CCC3(CC(=O)O)CCN(CCCCc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C30H37ClN2O4/c1-37-23-10-11-26-24(19-23)29(25(31)21-32-26)27(34)12-13-30(20-28(35)36)14-17-33(18-15-30)16-6-5-9-22-7-3-2-4-8-22/h2-4,7-8,10-11,19,21,27,34H,5-6,9,12-18,20H2,1H3,(H,35,36) |
| InChIKey | QECJUKJEKVREPB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|