C29H31ClF4N2O3 — CID 22470190
2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)propyl]piperidin-4-yl]acetic acid (PubChem CID 22470190) has the molecular formula C29H31ClF4N2O3 and a molecular weight of 567.02 g/mol. Its IUPAC name is 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)propyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)propyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22470190 |
| Molecular Formula | C29H31ClF4N2O3 |
| Molecular Weight | 567.02 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 2-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-fluoropropyl]-1-[3-(3,4,5-trifluorophenyl)propyl]piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(Cl)c(C(F)CCC3(CC(=O)O)CCN(CCCc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C29H31ClF4N2O3/c1-39-19-4-5-25-20(15-19)27(21(30)17-35-25)22(31)6-7-29(16-26(37)38)8-11-36(12-9-29)10-2-3-18-13-23(32)28(34)24(33)14-18/h4-5,13-15,17,22H,2-3,6-12,16H2,1H3,(H,37,38) |
| InChIKey | BQVABVGSVOPLOZ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.02 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|